![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| desktop.ini | 2016-04-18 12:15 | 318 | |
| AlbumArtSmall.jpg | 2016-04-18 12:15 | 2.2K | |
| AlbumArt_{C60A5BB4-F..> | 2016-04-18 12:15 | 2.2K | |
| AlbumArt_{C60A5BB4-F..> | 2016-04-18 12:15 | 8.1K | |
| Folder.jpg | 2016-04-18 12:15 | 8.1K | |
| F!N4LShare.txt | 2016-04-18 12:15 | 9.3K | |
| Capa.jpg | 2016-04-18 12:15 | 19K | |
| Thumbs.db | 2016-04-18 12:15 | 24K | |
| 06 - Your Emotions.mp3 | 2016-04-18 12:15 | 1.8M | |
| 03 - When Ya Get Dra..> | 2016-04-18 12:15 | 1.9M | |
| 02 - Forward to Deat..> | 2016-04-18 12:15 | 1.9M | |
| 11 - Funland at the ..> | 2016-04-18 12:15 | 2.5M | |
| 05 - Drug Me.mp3 | 2016-04-18 12:15 | 2.6M | |
| 09 - I Kill Children..> | 2016-04-18 12:15 | 2.8M | |
| 14 - Viva Las Vegas.mp3 | 2016-04-18 12:15 | 3.6M | |
| 12 - Ill in the Head..> | 2016-04-18 12:15 | 3.8M | |
| 07 - Chemical Warfar..> | 2016-04-18 12:15 | 4.0M | |
| 01 - Kill the Poor.mp3 | 2016-04-18 12:15 | 4.2M | |
| 13 - Holiday in Camb..> | 2016-04-18 12:15 | 6.3M | |